CAS 256425-32-8 is the registry number for 4,4-Dimethyl-2-(3-(methylthio)thiophen-2-yl)-4,5-dihydrooxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-2-(3-methylsulfanylthiophen-2-yl)-5H-1,3-oxazole (CAS 256425-32-8) is a chemical compound with the molecular formula C10H13NOS2 and a molecular weight of 227.4 g/mol. IUPAC name: 4,4-dimethyl-2-(3-methylsulfanylthiophen-2-yl)-5H-1,3-oxazole. InChIKey: RRGCQPOAEMJNJF-UHFFFAOYSA-N.
| Molecular formula | C10H13NOS2 |
|---|---|
| Molecular weight | 227.4 g/mol |
| IUPAC name | 4,4-dimethyl-2-(3-methylsulfanylthiophen-2-yl)-5H-1,3-oxazole |
| InChIKey | RRGCQPOAEMJNJF-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C=CS2)SC)C |
Computed by PubChem (NCBI)