Products 1867129-38-1
CAS 1867129-38-1 is the registry number for N3-Pen-Dde. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, Get quote.
2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione (CAS 1867129-38-1) is a chemical compound with the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. IUPAC name: 2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione. InChIKey: QJAIZMFMRIWAOC-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O3 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-(5-azido-1-hydroxypentylidene)-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | QJAIZMFMRIWAOC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(=C(CCCCN=[N+]=[N-])O)C(=O)C1)C |
Computed by PubChem (NCBI)