CAS 186774-62-9 appears in our catalog under these names: 6-Amino-2,2-dimethyl-chroman-4-one, 95%, 6-Amino-2,2-dimethylchroman-4-one, 98%, 6-Amino-2,2-dimethyl-chroman-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g.
6-amino-2,2-dimethyl-3H-chromen-4-one (CAS 186774-62-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 6-amino-2,2-dimethyl-3H-chromen-4-one. InChIKey: RLSGWLLNYBYPSZ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 6-amino-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | RLSGWLLNYBYPSZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)