CAS 18683-92-6 appears in our catalog under these names: Ambroxol Impurity 68, Ambroxol Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dibromo-3-cyclohexyl-2,4-dihydro-1H-quinazoline (CAS 18683-92-6) is a chemical compound with the molecular formula C14H18Br2N2 and a molecular weight of 374.11 g/mol. IUPAC name: 6,8-dibromo-3-cyclohexyl-2,4-dihydro-1H-quinazoline. InChIKey: QAAKUWHMWFVTFS-UHFFFAOYSA-N.
| Molecular formula | C14H18Br2N2 |
|---|---|
| Molecular weight | 374.11 g/mol |
| IUPAC name | 6,8-dibromo-3-cyclohexyl-2,4-dihydro-1H-quinazoline |
| InChIKey | QAAKUWHMWFVTFS-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2CC3=C(C(=CC(=C3)Br)Br)NC2 |
Computed by PubChem (NCBI)