CAS 53721-12-3 appears in our catalog under these names: Ethylviologen Dibromide, Ethylviologen Dibromide, Ethylviologen Dibromide, >98.0%(T)(HPLC), Ethyl viologen dibromide, 97%, 1,1'-Diethyl-[4,4'-bipyridine]-1,1'-diium bromide 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 1g, 5g, 25g.
1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium dibromide (CAS 53721-12-3) is a chemical compound with the molecular formula C14H18Br2N2 and a molecular weight of 374.11 g/mol. IUPAC name: 1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium dibromide. InChIKey: LCEBDKLPALDQPV-UHFFFAOYSA-L.
| Molecular formula | C14H18Br2N2 |
|---|---|
| Molecular weight | 374.11 g/mol |
| IUPAC name | 1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium dibromide |
| InChIKey | LCEBDKLPALDQPV-UHFFFAOYSA-L |
| SMILES | CC[N+]1=CC=C(C=C1)C2=CC=[N+](C=C2)CC.[Br-].[Br-] |
Computed by PubChem (NCBI)