CAS 18688-01-2 appears in our catalog under these names: 3,6-Dichlorogentisic Acid, Dicamba-5-hydroxy-desmethyl. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 250mg, 50mg.
2,5-dichloro-3,6-dihydroxybenzoic acid (CAS 18688-01-2) is a chemical compound with the molecular formula C7H4Cl2O4 and a molecular weight of 223.01 g/mol. IUPAC name: 2,5-dichloro-3,6-dihydroxybenzoic acid. InChIKey: TYIRNSZWLDSWDM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O4 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | 2,5-dichloro-3,6-dihydroxybenzoic acid |
| InChIKey | TYIRNSZWLDSWDM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)O)C(=O)O)Cl)O |
Computed by PubChem (NCBI)