CAS 59119-79-8 is the registry number for tert-Butyl 8-azabicyclo[3.2.1]octane-8-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3,5-dichloro-2,4-dihydroxybenzoic acid (CAS 59119-79-8) is a chemical compound with the molecular formula C7H4Cl2O4 and a molecular weight of 223.01 g/mol. IUPAC name: 3,5-dichloro-2,4-dihydroxybenzoic acid. InChIKey: FCOWQHCAVUUGCS-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O4 |
|---|---|
| Molecular weight | 223.01 g/mol |
| IUPAC name | 3,5-dichloro-2,4-dihydroxybenzoic acid |
| InChIKey | FCOWQHCAVUUGCS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)O)Cl)O)C(=O)O |
Computed by PubChem (NCBI)