CAS 18692-68-7 is the registry number for ACETIC ACID 2–METHOXY–4–(5–OXO–2–PHENYL–OXAZOL–4–YLIDENEMETHYL)–PHENYL ESTER. Offered by: GLPBio. Available pack sizes: 100mg.
[2-methoxy-4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate (CAS 18692-68-7) is a chemical compound with the molecular formula C19H15NO5 and a molecular weight of 337.3 g/mol. IUPAC name: [2-methoxy-4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate. InChIKey: WZSKLTVIGWVEKR-XNTDXEJSSA-N.
| Molecular formula | C19H15NO5 |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | [2-methoxy-4-[(E)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate |
| InChIKey | WZSKLTVIGWVEKR-XNTDXEJSSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)/C=C/2\C(=O)OC(=N2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)