Products 355428-84-1
CAS 355428-84-1 is the registry number for 3HOI-BA-01. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-1H-indol-2-one (CAS 355428-84-1) is a chemical compound with the molecular formula C19H15NO5 and a molecular weight of 337.3 g/mol. IUPAC name: 3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-1H-indol-2-one. InChIKey: AJJYRWYJJMMKIT-FNORWQNLSA-N.
| Molecular formula | C19H15NO5 |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | 3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-1H-indol-2-one |
| InChIKey | AJJYRWYJJMMKIT-FNORWQNLSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)CC3(C4=CC=CC=C4NC3=O)O |
Computed by PubChem (NCBI)