CAS 18698-99-2 appears in our catalog under these names: 2-(2-Cyanophenyl)acetic acid, 95%, 2–Cyanophenylacetic Acid, (2-Cyanophenyl)acetic acid 97%, 2-Cyanobenzeneacetic Acid, 97%, 97%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
2-(2-cyanophenyl)acetic acid (CAS 18698-99-2) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-(2-cyanophenyl)acetic acid. InChIKey: QLHZKPQKYARBGT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(2-cyanophenyl)acetic acid |
| InChIKey | QLHZKPQKYARBGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C#N |
Computed by PubChem (NCBI)