CAS 18699-87-1 appears in our catalog under these names: 2–Methyl–3–nitropyridine, 2-Methyl-3-nitropyridine, >98.0%(GC), 2-Methyl-3-nitropyridine, 97%, 3-nitropicoline 98%, 2-Methyl-3-nitropyridine, 98%, 98%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
2-methyl-3-nitropyridine (CAS 18699-87-1) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-methyl-3-nitropyridine. InChIKey: CCFGTKQIRWHYTB-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 2-methyl-3-nitropyridine |
| InChIKey | CCFGTKQIRWHYTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)