Products 1869980-95-9

CAS 1869980-95-9 is the registry number for 3-(2-(Azetidin-1-yl)ethyl)thietane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[2-(azetidin-1-yl)ethyl]thietane 1,1-dioxide (CAS 1869980-95-9) is a chemical compound with the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. IUPAC name: 3-[2-(azetidin-1-yl)ethyl]thietane 1,1-dioxide. InChIKey: LUMJEWJRBTULLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO2S
Molecular weight189.28 g/mol
IUPAC name3-[2-(azetidin-1-yl)ethyl]thietane 1,1-dioxide
InChIKeyLUMJEWJRBTULLJ-UHFFFAOYSA-N
SMILESC1CN(C1)CCC2CS(=O)(=O)C2

Computed by PubChem (NCBI)