Products 943437-98-7

CAS 943437-98-7 appears in our catalog under these names: Thietan-3-yl-carbamic acid tert-butyl ester, 95%, N-3-Thietanylcarbamic acid 1,1-Dimethylethyl Ester, tert-Butyl thietan-3-ylcarbamate, 97%, 97%, tert-Butyl thietan-3-ylcarbamate, 95%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(thietan-3-yl)carbamate (CAS 943437-98-7) is a chemical compound with the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. IUPAC name: tert-butyl N-(thietan-3-yl)carbamate. InChIKey: GXDVIWSAGRLVMF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO2S
Molecular weight189.28 g/mol
IUPAC nametert-butyl N-(thietan-3-yl)carbamate
InChIKeyGXDVIWSAGRLVMF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CSC1

Computed by PubChem (NCBI)