CAS 1871808-72-8 is the registry number for 3-(Methylsulfonyl)-3-azabicyclo(3.1.0)hexan-6-amine-hydrochloride. Offered by: TRC. Available pack sizes: 750mg.
(1R,5S)-3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-6-amine;hydrochloride (CAS 1871808-72-8) is a chemical compound with the molecular formula C6H13ClN2O2S and a molecular weight of 212.70 g/mol. IUPAC name: (1R,5S)-3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-6-amine;hydrochloride. InChIKey: XAAVYVIPODUHKD-FTEHNKOGSA-N.
| Molecular formula | C6H13ClN2O2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | (1R,5S)-3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-6-amine;hydrochloride |
| InChIKey | XAAVYVIPODUHKD-FTEHNKOGSA-N |
| SMILES | CS(=O)(=O)N1C[C@@H]2[C@H](C1)C2N.Cl |
Computed by PubChem (NCBI)