Products 2435623-12-2

CAS 2435623-12-2 is the registry number for 2-Thia-3,7-diazaspiro[4.4]nonane 2,2-dioxide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2lambda6-thia-3,7-diazaspiro[4.4]nonane 2,2-dioxide;hydrochloride (CAS 2435623-12-2) is a chemical compound with the molecular formula C6H13ClN2O2S and a molecular weight of 212.70 g/mol. IUPAC name: 2lambda6-thia-3,7-diazaspiro[4.4]nonane 2,2-dioxide;hydrochloride. InChIKey: UGUIRQRRLIIZQD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClN2O2S
Molecular weight212.70 g/mol
IUPAC name2lambda6-thia-3,7-diazaspiro[4.4]nonane 2,2-dioxide;hydrochloride
InChIKeyUGUIRQRRLIIZQD-UHFFFAOYSA-N
SMILESC1CNCC12CNS(=O)(=O)C2.Cl

Computed by PubChem (NCBI)