Products 1872-40-8
CAS 1872-40-8 is the registry number for 4,6-Dinitroisophthalic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
4,6-dinitrobenzene-1,3-dicarboxylic acid (CAS 1872-40-8) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 4,6-dinitrobenzene-1,3-dicarboxylic acid. InChIKey: USNQORATWWPXHQ-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O8 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 4,6-dinitrobenzene-1,3-dicarboxylic acid |
| InChIKey | USNQORATWWPXHQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)