Products 2300-16-5

CAS 2300-16-5 is the registry number for 3,6-Dinitrobenzene-1,2-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3,6-dinitrophthalic acid (CAS 2300-16-5) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 3,6-dinitrophthalic acid. InChIKey: MZDSOZBFTCRKNT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4N2O8
Molecular weight256.13 g/mol
IUPAC name3,6-dinitrophthalic acid
InChIKeyMZDSOZBFTCRKNT-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)