CAS 2300-16-5 is the registry number for 3,6-Dinitrobenzene-1,2-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,6-dinitrophthalic acid (CAS 2300-16-5) is a chemical compound with the molecular formula C8H4N2O8 and a molecular weight of 256.13 g/mol. IUPAC name: 3,6-dinitrophthalic acid. InChIKey: MZDSOZBFTCRKNT-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O8 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 3,6-dinitrophthalic acid |
| InChIKey | MZDSOZBFTCRKNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)