CAS 18720-35-9 appears in our catalog under these names: 4–(Methoxycarbonyl)bicyclo(2·2·2)octan–1–carboxylic Acid, 4-(Methoxycarbonyl)bicyclo[2.2.2]octan-1-carboxylic Acid, >98.0%(GC)(T), 4-(Methoxycarbonyl)bicyclo(2.2.2)octane-1-carboxylic acid, 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid, 99.95%, 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid, 97%. Offered by: GLPBio, TCI, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 0,5g, 2g, 10g, 1 g.
4-methoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid (CAS 18720-35-9) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 4-methoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid. InChIKey: KBZVAQVEHVGIEI-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-methoxycarbonylbicyclo[2.2.2]octane-1-carboxylic acid |
| InChIKey | KBZVAQVEHVGIEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2)C(=O)O |
Computed by PubChem (NCBI)