CAS 18721-65-8 appears in our catalog under these names: 1-tert-Butyl 1-ethyl cyclopropane-1,1-dicarboxylate, 95%, 1-tert-Butyl 1-ethyl cyclopropane-1,1-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-O'-tert-butyl 1-O-ethyl cyclopropane-1,1-dicarboxylate (CAS 18721-65-8) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 1-O'-tert-butyl 1-O-ethyl cyclopropane-1,1-dicarboxylate. InChIKey: MKCXJELMPORVPF-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-O'-tert-butyl 1-O-ethyl cyclopropane-1,1-dicarboxylate |
| InChIKey | MKCXJELMPORVPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)