CAS 187222-18-0 appears in our catalog under these names: Methyl 4-methoxy-3,5-dimethylpicolinate, 95%, Omeprazole Impurity 27, Methyl 4–methoxy–3,5–dimethylpicolinate, Methyl 4-methoxy-3,5-dimethylpicolinate 95%, Methyl 4-methoxy-3,5-dimethylpicolinate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, on request.
Methyl 4-methoxy-3,5-dimethylpyridine-2-carboxylate (CAS 187222-18-0) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: methyl 4-methoxy-3,5-dimethylpyridine-2-carboxylate. InChIKey: IFQLJYFNYDIFEE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | methyl 4-methoxy-3,5-dimethylpyridine-2-carboxylate |
| InChIKey | IFQLJYFNYDIFEE-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)C(=O)OC |
Computed by PubChem (NCBI)