CAS 1872341-39-3 appears in our catalog under these names: 5-Methyl-1-(3-methylbutan-2-yl)-1H-pyrazole-4-carboxylic acid, 95%, 5-Methyl-1-(3-methylbutan-2-yl)-1H-pyrazole-4-carboxylic acid, Dimpropyridaz Metabolite M550I006. Offered by: AmBeed, Biosynth, HPC Standards. Available pack sizes: 1g, 0,5g, 50mg, 1x10mg.
5-methyl-1-(3-methylbutan-2-yl)pyrazole-4-carboxylic acid (CAS 1872341-39-3) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 5-methyl-1-(3-methylbutan-2-yl)pyrazole-4-carboxylic acid. InChIKey: ZANKQPFRINQWLM-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 5-methyl-1-(3-methylbutan-2-yl)pyrazole-4-carboxylic acid |
| InChIKey | ZANKQPFRINQWLM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C(C)C(C)C)C(=O)O |
Computed by PubChem (NCBI)