Products 1874188-30-3
CAS 1874188-30-3 is the registry number for 5-{1-((tert-Butoxy)carbonyl)pyrrolidin-3-yl}-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-1,3-oxazole-4-carboxylic acid (CAS 1874188-30-3) is a chemical compound with the molecular formula C13H18N2O5 and a molecular weight of 282.29 g/mol. IUPAC name: 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-1,3-oxazole-4-carboxylic acid. InChIKey: ZEWUILIITFKJPY-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | ZEWUILIITFKJPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)