CAS 1874200-71-1 appears in our catalog under these names: 2'–Amino–(1,1':4',1''–terphenyl)–3,3'',5,5''–tetracarboxylic acid, 2'-Amino-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 98%, 98%, 2'-Amino-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g.
5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 1874200-71-1) is a chemical compound with the molecular formula C22H15NO8 and a molecular weight of 421.4 g/mol. IUPAC name: 5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: PUZBJBMUFJIHTL-UHFFFAOYSA-N.
| Molecular formula | C22H15NO8 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | 5-[3-amino-4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | PUZBJBMUFJIHTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)N)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)