CAS 2426561-00-2 is the registry number for 5,5'-(3-Methylpyridine-2,5-diyl)diisophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[6-(3,5-dicarboxyphenyl)-5-methyl-3-pyridinyl]benzene-1,3-dicarboxylic acid (CAS 2426561-00-2) is a chemical compound with the molecular formula C22H15NO8 and a molecular weight of 421.4 g/mol. IUPAC name: 5-[6-(3,5-dicarboxyphenyl)-5-methyl-3-pyridinyl]benzene-1,3-dicarboxylic acid. InChIKey: XFKISZHXBRSZMG-UHFFFAOYSA-N.
| Molecular formula | C22H15NO8 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | 5-[6-(3,5-dicarboxyphenyl)-5-methyl-3-pyridinyl]benzene-1,3-dicarboxylic acid |
| InChIKey | XFKISZHXBRSZMG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)