CAS 1874643-68-1 is the registry number for 2-(Trifluoromethyl)oxane-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(trifluoromethyl)oxane-4-sulfonyl chloride (CAS 1874643-68-1) is a chemical compound with the molecular formula C6H8ClF3O3S and a molecular weight of 252.64 g/mol. IUPAC name: 2-(trifluoromethyl)oxane-4-sulfonyl chloride. InChIKey: YKICDCCDAJBAMS-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF3O3S |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | 2-(trifluoromethyl)oxane-4-sulfonyl chloride |
| InChIKey | YKICDCCDAJBAMS-UHFFFAOYSA-N |
| SMILES | C1COC(CC1S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)