CAS 2126162-12-5 is the registry number for (5-(Trifluoromethyl)oxolan-2-yl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-(trifluoromethyl)oxolan-2-yl]methanesulfonyl chloride (CAS 2126162-12-5) is a chemical compound with the molecular formula C6H8ClF3O3S and a molecular weight of 252.64 g/mol. IUPAC name: [5-(trifluoromethyl)oxolan-2-yl]methanesulfonyl chloride. InChIKey: PERNUUIYRUMPMG-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF3O3S |
|---|---|
| Molecular weight | 252.64 g/mol |
| IUPAC name | [5-(trifluoromethyl)oxolan-2-yl]methanesulfonyl chloride |
| InChIKey | PERNUUIYRUMPMG-UHFFFAOYSA-N |
| SMILES | C1CC(OC1CS(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)