CAS 18755-57-2 appears in our catalog under these names: 4–(1–hydroxy–2–methylpropan–2–yl)benzonitrile, 4-(1-Hydroxy-2-methylpropan-2-yl)benzonitrile. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-(1-hydroxy-2-methylpropan-2-yl)benzonitrile (CAS 18755-57-2) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 4-(1-hydroxy-2-methylpropan-2-yl)benzonitrile. InChIKey: BJZPEAMLPSMWFL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 4-(1-hydroxy-2-methylpropan-2-yl)benzonitrile |
| InChIKey | BJZPEAMLPSMWFL-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)