CAS 1875674-53-5 is the registry number for Sodium (2–oxocyclopentylidene)methanolate. Offered by: GLPBio. Available pack sizes: 100mg, 10g, 1g, 2,5g, 250mg, 50mg, 500mg, 5g.
Sodium (Z)-(2-oxocyclopentylidene)methanolate (CAS 1875674-53-5) is a chemical compound with the molecular formula C6H7NaO2 and a molecular weight of 134.11 g/mol. IUPAC name: sodium (Z)-(2-oxocyclopentylidene)methanolate. InChIKey: YDLKWKZWPMZTIH-MKWAYWHRSA-M.
| Molecular formula | C6H7NaO2 |
|---|---|
| Molecular weight | 134.11 g/mol |
| IUPAC name | sodium (Z)-(2-oxocyclopentylidene)methanolate |
| InChIKey | YDLKWKZWPMZTIH-MKWAYWHRSA-M |
| SMILES | C1C/C(=C/[O-])/C(=O)C1.[Na+] |
Computed by PubChem (NCBI)