CAS 56260-48-1 is the registry number for Sodium 3–cyclopropyl–3–oxoprop–1–en–1–olate. Offered by: GLPBio. Available pack sizes: 100mg, 10g, 1g, 2,5g, 250mg, 50mg, 500mg, 5g.
Sodium (E)-3-cyclopropyl-3-oxoprop-1-en-1-olate (CAS 56260-48-1) is a chemical compound with the molecular formula C6H7NaO2 and a molecular weight of 134.11 g/mol. IUPAC name: sodium (E)-3-cyclopropyl-3-oxoprop-1-en-1-olate. InChIKey: JTEQXVRLUUCHLW-BJILWQEISA-M.
| Molecular formula | C6H7NaO2 |
|---|---|
| Molecular weight | 134.11 g/mol |
| IUPAC name | sodium (E)-3-cyclopropyl-3-oxoprop-1-en-1-olate |
| InChIKey | JTEQXVRLUUCHLW-BJILWQEISA-M |
| SMILES | C1CC1C(=O)/C=C/[O-].[Na+] |
Computed by PubChem (NCBI)