Products 1876270-49-3
CAS 1876270-49-3 is the registry number for N-(4-Bromophenyl)-2-methoxy-2-methylpropanamide, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-(4-bromophenyl)-2-methoxy-2-methylpropanamide (CAS 1876270-49-3) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: N-(4-bromophenyl)-2-methoxy-2-methylpropanamide. InChIKey: CEUQFGWYYKQVHV-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-methoxy-2-methylpropanamide |
| InChIKey | CEUQFGWYYKQVHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC=C(C=C1)Br)OC |
Computed by PubChem (NCBI)