Products 1876328-40-3
CAS 1876328-40-3 is the registry number for benzyl N-(5-chloro-2-fluorophenyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl N-(5-chloro-2-fluorophenyl)carbamate (CAS 1876328-40-3) is a chemical compound with the molecular formula C14H11ClFNO2 and a molecular weight of 279.69 g/mol. IUPAC name: benzyl N-(5-chloro-2-fluorophenyl)carbamate. InChIKey: PDRXHXUIVRHJKC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO2 |
|---|---|
| Molecular weight | 279.69 g/mol |
| IUPAC name | benzyl N-(5-chloro-2-fluorophenyl)carbamate |
| InChIKey | PDRXHXUIVRHJKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C(C=CC(=C2)Cl)F |
Computed by PubChem (NCBI)