CAS 1798789-32-8 is the registry number for 4-Chloro-3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-chloro-3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)pyridine (CAS 1798789-32-8) is a chemical compound with the molecular formula C14H11ClFNO2 and a molecular weight of 279.69 g/mol. IUPAC name: 4-chloro-3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)pyridine. InChIKey: QLEWNYWSSRLVJV-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO2 |
|---|---|
| Molecular weight | 279.69 g/mol |
| IUPAC name | 4-chloro-3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)pyridine |
| InChIKey | QLEWNYWSSRLVJV-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CN=C2C3=CC=C(C=C3)F)Cl |
Computed by PubChem (NCBI)