Products 1218090-79-9
CAS 1218090-79-9 is the registry number for 2-((2-Chlorophenyl)amino)-2-(2-fluorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-chloroanilino)-2-(2-fluorophenyl)acetic acid (CAS 1218090-79-9) is a chemical compound with the molecular formula C14H11ClFNO2 and a molecular weight of 279.69 g/mol. IUPAC name: 2-(2-chloroanilino)-2-(2-fluorophenyl)acetic acid. InChIKey: MZPVUMFEEMAPRR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO2 |
|---|---|
| Molecular weight | 279.69 g/mol |
| IUPAC name | 2-(2-chloroanilino)-2-(2-fluorophenyl)acetic acid |
| InChIKey | MZPVUMFEEMAPRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)NC2=CC=CC=C2Cl)F |
Computed by PubChem (NCBI)