CAS 1879026-07-9 is the registry number for 5-Chloro-2,6-dimethoxy-3-pyridinecarboxaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
5-chloro-2,6-dimethoxypyridine-3-carbaldehyde (CAS 1879026-07-9) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-2,6-dimethoxypyridine-3-carbaldehyde. InChIKey: BLWPGTRSNBITAP-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 5-chloro-2,6-dimethoxypyridine-3-carbaldehyde |
| InChIKey | BLWPGTRSNBITAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C=O)Cl |
Computed by PubChem (NCBI)