CAS 187998-35-2 appears in our catalog under these names: 1-(4-Chlorophenyl)-5-methyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Chlorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 97% , 1-(4-Chlorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid 95%, 1-(4-Chlorophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-(4-Chloro-phenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
1-(4-chlorophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 187998-35-2) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: OAPQKGGVDCZENK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | OAPQKGGVDCZENK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)