Products 1880070-43-8
CAS 1880070-43-8 is the registry number for 8-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol (CAS 1880070-43-8) is a chemical compound with the molecular formula C14H16Cl2O3 and a molecular weight of 303.2 g/mol. IUPAC name: 8-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol. InChIKey: FZYBXDOJEIMDIZ-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2O3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 8-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| InChIKey | FZYBXDOJEIMDIZ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C3=C(C=C(C=C3)Cl)Cl)O)OCCO2 |
Computed by PubChem (NCBI)