CAS 188106-81-2 appears in our catalog under these names: 1H-Benzo(d)imidazole-4-carboxamide, 95+%, 1H-1,3-Benzodiazole-4-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1H-benzimidazole-4-carboxamide (CAS 188106-81-2) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 1H-benzimidazole-4-carboxamide. InChIKey: JJDMKDXGNVJWCD-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1H-benzimidazole-4-carboxamide |
| InChIKey | JJDMKDXGNVJWCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=N2)C(=O)N |
Computed by PubChem (NCBI)