Products 1881085-17-1
CAS 1881085-17-1 appears in our catalog under these names: 2-(5-Bromo-3-fluoropyridin-2-yl)-2-methylpropanoic acid, 97%, 2-(5-bromo-3-fluoro-2-pyridyl)-2-methyl-propanoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
2-(5-bromo-3-fluoro-2-pyridinyl)-2-methylpropanoic acid (CAS 1881085-17-1) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: 2-(5-bromo-3-fluoro-2-pyridinyl)-2-methylpropanoic acid. InChIKey: PTXITVMXCLXXKZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 2-(5-bromo-3-fluoro-2-pyridinyl)-2-methylpropanoic acid |
| InChIKey | PTXITVMXCLXXKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=N1)Br)F)C(=O)O |
Computed by PubChem (NCBI)