CAS 188112-22-3 is the registry number for 2-Bromo-N-tritylacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-tritylacetamide (CAS 188112-22-3) is a chemical compound with the molecular formula C21H18BrNO and a molecular weight of 380.3 g/mol. IUPAC name: 2-bromo-N-tritylacetamide. InChIKey: YLBCXNPYKQXKLG-UHFFFAOYSA-N.
| Molecular formula | C21H18BrNO |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | 2-bromo-N-tritylacetamide |
| InChIKey | YLBCXNPYKQXKLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CBr |
Computed by PubChem (NCBI)