CAS 349439-57-2 is the registry number for N-(2-Bromophenyl)-3,3-diphenylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(2-bromophenyl)-3,3-diphenylpropanamide (CAS 349439-57-2) is a chemical compound with the molecular formula C21H18BrNO and a molecular weight of 380.3 g/mol. IUPAC name: N-(2-bromophenyl)-3,3-diphenylpropanamide. InChIKey: ZGKPMMRKLGJYCL-UHFFFAOYSA-N.
| Molecular formula | C21H18BrNO |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | N-(2-bromophenyl)-3,3-diphenylpropanamide |
| InChIKey | ZGKPMMRKLGJYCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)NC2=CC=CC=C2Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)