Products 1881276-00-1
CAS 1881276-00-1 is the registry number for AI-10-104, 98.92%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.
2-(3-methoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole (CAS 1881276-00-1) is a chemical compound with the molecular formula C14H10F3N3O2 and a molecular weight of 309.24 g/mol. IUPAC name: 2-(3-methoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole. InChIKey: OIIHJPSDBLPWEL-UHFFFAOYSA-N.
| Molecular formula | C14H10F3N3O2 |
|---|---|
| Molecular weight | 309.24 g/mol |
| IUPAC name | 2-(3-methoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole |
| InChIKey | OIIHJPSDBLPWEL-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC=C1)C2=NC3=C(N2)C=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)