CAS 338959-50-5 is the registry number for Ethyl 1-(3-cyanophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 1-(3-cyanophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate (CAS 338959-50-5) is a chemical compound with the molecular formula C14H10F3N3O2 and a molecular weight of 309.24 g/mol. IUPAC name: ethyl 1-(3-cyanophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate. InChIKey: NLOMDRDZZCLQSE-UHFFFAOYSA-N.
| Molecular formula | C14H10F3N3O2 |
|---|---|
| Molecular weight | 309.24 g/mol |
| IUPAC name | ethyl 1-(3-cyanophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| InChIKey | NLOMDRDZZCLQSE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=CC(=C2)C#N)C(F)(F)F |
Computed by PubChem (NCBI)