CAS 1881277-32-2 appears in our catalog under these names: Resolvin D1–d5, Resolvin D1-d5, 99.2%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10μg, 25μg, 25 μg (262.11 µM * 250 μL in Ethanol), 10 μg (262.11 µM * 100 μL in Ethanol).
(4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-21,21,22,22,22-pentadeuterio-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoic acid (CAS 1881277-32-2) is a chemical compound with the molecular formula C22H32O5 and a molecular weight of 381.5 g/mol. IUPAC name: (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-21,21,22,22,22-pentadeuterio-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoic acid. InChIKey: OIWTWACQMDFHJG-CLQVKFETSA-N.
| Molecular formula | C22H32O5 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-21,21,22,22,22-pentadeuterio-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoic acid |
| InChIKey | OIWTWACQMDFHJG-CLQVKFETSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C=C\C[C@@H](\C=C\C=C/C=C/C=C/[C@H]([C@H](C/C=C\CCC(=O)O)O)O)O |
Computed by PubChem (NCBI)