Products 1881277-33-3
CAS 1881277-33-3 appears in our catalog under these names: Resolvin D2–d5, Resolvin d2-d5, Resolvin D2-d5, 99.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10μg, 1mg, 25μg, 10 μg (262.11 µM * 100 μL in Ethanol).
(4Z,7S,8E,10Z,12E,14E,16R,17S,19Z)-21,21,22,22,22-pentadeuterio-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid (CAS 1881277-33-3) is a chemical compound with the molecular formula C22H32O5 and a molecular weight of 381.5 g/mol. IUPAC name: (4Z,7S,8E,10Z,12E,14E,16R,17S,19Z)-21,21,22,22,22-pentadeuterio-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid. InChIKey: IKFAUGXNBOBQDM-XNSNRJMHSA-N.
| Molecular formula | C22H32O5 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (4Z,7S,8E,10Z,12E,14E,16R,17S,19Z)-21,21,22,22,22-pentadeuterio-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
| InChIKey | IKFAUGXNBOBQDM-XNSNRJMHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C=C\C[C@@H]([C@@H](\C=C\C=C\C=C/C=C/[C@H](C/C=C\CCC(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Resolvin D2-d5, RvD2-d5