Products 1881289-32-2
CAS 1881289-32-2 is the registry number for tert-butyl N-(4-chloro-3-fluorophenyl)-N-ethylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(4-chloro-3-fluorophenyl)-N-ethylcarbamate (CAS 1881289-32-2) is a chemical compound with the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. IUPAC name: tert-butyl N-(4-chloro-3-fluorophenyl)-N-ethylcarbamate. InChIKey: UOMRQJOPIGLMHV-UHFFFAOYSA-N.
| Molecular formula | C13H17ClFNO2 |
|---|---|
| Molecular weight | 273.73 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-3-fluorophenyl)-N-ethylcarbamate |
| InChIKey | UOMRQJOPIGLMHV-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC(=C(C=C1)Cl)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)