Products 1198287-33-0

CAS 1198287-33-0 is the registry number for 2-Fluoro-4-piperidin-4-yl-benzoic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Methyl 2-fluoro-4-piperidin-4-ylbenzoate;hydrochloride (CAS 1198287-33-0) is a chemical compound with the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. IUPAC name: methyl 2-fluoro-4-piperidin-4-ylbenzoate;hydrochloride. InChIKey: SLEFBQQFZUKVRS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClFNO2
Molecular weight273.73 g/mol
IUPAC namemethyl 2-fluoro-4-piperidin-4-ylbenzoate;hydrochloride
InChIKeySLEFBQQFZUKVRS-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2CCNCC2)F.Cl

Computed by PubChem (NCBI)