Products 939756-64-6

CAS 939756-64-6 is the registry number for a-(4-Fluorophenyl)-1-piperidineacetic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride (CAS 939756-64-6) is a chemical compound with the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride. InChIKey: HVMRBLCWQORUQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClFNO2
Molecular weight273.73 g/mol
IUPAC name2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride
InChIKeyHVMRBLCWQORUQQ-UHFFFAOYSA-N
SMILESC1CCN(CC1)C(C2=CC=C(C=C2)F)C(=O)O.Cl

Computed by PubChem (NCBI)