CAS 939756-64-6 is the registry number for a-(4-Fluorophenyl)-1-piperidineacetic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride (CAS 939756-64-6) is a chemical compound with the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride. InChIKey: HVMRBLCWQORUQQ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClFNO2 |
|---|---|
| Molecular weight | 273.73 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-piperidin-1-ylacetic acid;hydrochloride |
| InChIKey | HVMRBLCWQORUQQ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(C2=CC=C(C=C2)F)C(=O)O.Cl |
Computed by PubChem (NCBI)