Products 1881291-03-7
CAS 1881291-03-7 is the registry number for tert-butyl N-(4-chloro-3-fluorophenyl)-N-propylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(4-chloro-3-fluorophenyl)-N-propylcarbamate (CAS 1881291-03-7) is a chemical compound with the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. IUPAC name: tert-butyl N-(4-chloro-3-fluorophenyl)-N-propylcarbamate. InChIKey: OVRHKILQDQKWDH-UHFFFAOYSA-N.
| Molecular formula | C14H19ClFNO2 |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-3-fluorophenyl)-N-propylcarbamate |
| InChIKey | OVRHKILQDQKWDH-UHFFFAOYSA-N |
| SMILES | CCCN(C1=CC(=C(C=C1)Cl)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)