CAS 2703832-68-0 is the registry number for (±)-threo-4-Fluoromethylphenidate (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
Methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 2703832-68-0) is a chemical compound with the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. IUPAC name: methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: NCCJEXAXCWALQG-OJERSXHUSA-N.
| Molecular formula | C14H19ClFNO2 |
|---|---|
| Molecular weight | 287.76 g/mol |
| IUPAC name | methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | NCCJEXAXCWALQG-OJERSXHUSA-N |
| SMILES | COC(=O)[C@@H]([C@H]1CCCCN1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)