Products 1881291-62-8
CAS 1881291-62-8 is the registry number for benzyl N-(3-chloro-5-nitrophenyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl N-(3-chloro-5-nitrophenyl)carbamate (CAS 1881291-62-8) is a chemical compound with the molecular formula C14H11ClN2O4 and a molecular weight of 306.70 g/mol. IUPAC name: benzyl N-(3-chloro-5-nitrophenyl)carbamate. InChIKey: QURUKQNWSNPMCT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O4 |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | benzyl N-(3-chloro-5-nitrophenyl)carbamate |
| InChIKey | QURUKQNWSNPMCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)